C20H21N3O6S — CID 108836151
4-[[(Z)-2-cyano-3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzenesulfonic acid (PubChem CID 108836151) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108836151 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzenesulfonic acid |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C\Nc2ccc(S(=O)(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C20H21N3O6S/c1-28-18-8-3-14(11-19(18)29-2)9-10-22-20(24)15(12-21)13-23-16-4-6-17(7-5-16)30(25,26)27/h3-8,11,13,23H,9-10H2,1-2H3,(H,22,24)(H,25,26,27)/b15-13- |
| InChIKey | VQXQFAJKLPWMMJ-SQFISAMPSA-N |
| XLogP | 2.13 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|