C22H20N2O4 — CID 24582628
(E)-3-(1-benzofuran-2-yl)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide (PubChem CID 24582628) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (E)-3-(1-benzofuran-2-yl)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzofuran-2-yl)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 24582628 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (E)-3-(1-benzofuran-2-yl)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C/c2cc3ccccc3o2)cc1OC |
| InChI | InChI=1S/C22H20N2O4/c1-26-20-8-7-15(11-21(20)27-2)9-10-24-22(25)17(14-23)13-18-12-16-5-3-4-6-19(16)28-18/h3-8,11-13H,9-10H2,1-2H3,(H,24,25)/b17-13+ |
| InChIKey | MQODOVINJPOIDA-GHRIWEEISA-N |
| XLogP | 3.72 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|