C12H7BrN2O2 — CID 163897321
(E)-3-(5-bromo-1H-indol-3-yl)-2-cyanoprop-2-enoic acid (PubChem CID 163897321) has the molecular formula C12H7BrN2O2 and a molecular weight of 291.10 g/mol. Its IUPAC name is (E)-3-(5-bromo-1H-indol-3-yl)-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-(5-bromo-1H-indol-3-yl)-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 163897321 |
| Molecular Formula | C12H7BrN2O2 |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | (E)-3-(5-bromo-1H-indol-3-yl)-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1c[nH]c2ccc(Br)cc12)C(=O)O |
| InChI | InChI=1S/C12H7BrN2O2/c13-9-1-2-11-10(4-9)8(6-15-11)3-7(5-14)12(16)17/h1-4,6,15H,(H,16,17)/b7-3+ |
| InChIKey | QGULCNWTYAZGOP-XVNBXDOJSA-N |
| XLogP | 2.92 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|