C18H11Cl3N2O2S — CID 25052503
(E)-3-(5-chloro-1H-indol-3-yl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enenitrile (PubChem CID 25052503) has the molecular formula C18H11Cl3N2O2S and a molecular weight of 425.72 g/mol. Its IUPAC name is (E)-3-(5-chloro-1H-indol-3-yl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(5-chloro-1H-indol-3-yl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 25052503 |
| Molecular Formula | C18H11Cl3N2O2S |
| Molecular Weight | 425.72 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | (E)-3-(5-chloro-1H-indol-3-yl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1c[nH]c2ccc(Cl)cc12)S(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H11Cl3N2O2S/c19-13-3-4-18-16(6-13)12(9-23-18)5-15(8-22)26(24,25)10-11-1-2-14(20)7-17(11)21/h1-7,9,23H,10H2/b15-5+ |
| InChIKey | NIAMJNJROORJGC-PJQLUOCWSA-N |
| XLogP | 5.61 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.72 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|