C9H10Cl2FNO2S — CID 59623734
1-(2,4-dichlorophenyl)-N-(2-fluoroethyl)methanesulfonamide (PubChem CID 59623734) has the molecular formula C9H10Cl2FNO2S and a molecular weight of 286.16 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-(2-fluoroethyl)methanesulfonamide.
| Compound Name | 1-(2,4-dichlorophenyl)-N-(2-fluoroethyl)methanesulfonamide |
|---|---|
| PubChem CID | 59623734 |
| Molecular Formula | C9H10Cl2FNO2S |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-(2-fluoroethyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1Cl)NCCF |
| InChI | InChI=1S/C9H10Cl2FNO2S/c10-8-2-1-7(9(11)5-8)6-16(14,15)13-4-3-12/h1-2,5,13H,3-4,6H2 |
| InChIKey | LLZVNLBOJWFQAB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |