C7H6Cl3NS — CID 142470358
2,4-dichloro-1-[(chloroamino)sulfanylmethyl]benzene (PubChem CID 142470358) has the molecular formula C7H6Cl3NS and a molecular weight of 242.56 g/mol. Its IUPAC name is 2,4-dichloro-1-[(chloroamino)sulfanylmethyl]benzene.
| Compound Name | 2,4-dichloro-1-[(chloroamino)sulfanylmethyl]benzene |
|---|---|
| PubChem CID | 142470358 |
| Molecular Formula | C7H6Cl3NS |
| Molecular Weight | 242.56 g/mol |
| Exact Mass | 240.93 |
| IUPAC Name | 2,4-dichloro-1-[(chloroamino)sulfanylmethyl]benzene |
| SMILES | ClNSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H6Cl3NS/c8-6-2-1-5(4-12-11-10)7(9)3-6/h1-3,11H,4H2 |
| InChIKey | PQPGNWLYAXHUHZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|