C10H13Cl3N2O4S — CID 44887465
[(2,4-dichlorophenyl)methylsulfanyl-(methylamino)methylidene]-methylazanium perchlorate (PubChem CID 44887465) has the molecular formula C10H13Cl3N2O4S and a molecular weight of 363.65 g/mol. Its IUPAC name is [(2,4-dichlorophenyl)methylsulfanyl-(methylamino)methylidene]-methylazanium perchlorate.
| Compound Name | [(2,4-dichlorophenyl)methylsulfanyl-(methylamino)methylidene]-methylazanium perchlorate |
|---|---|
| PubChem CID | 44887465 |
| Molecular Formula | C10H13Cl3N2O4S |
| Molecular Weight | 363.65 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | [(2,4-dichlorophenyl)methylsulfanyl-(methylamino)methylidene]-methylazanium perchlorate |
| SMILES | CN/C(=[NH+]\C)SCc1ccc(Cl)cc1Cl.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C10H12Cl2N2S.ClHO4/c1-13-10(14-2)15-6-7-3-4-8(11)5-9(7)12;2-1(3,4)5/h3-5H,6H2,1-2H3,(H,13,14);(H,2,3,4,5) |
| InChIKey | FBWZNOMOIWSAHV-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 118.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.65 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|