C14H12Cl2OS — CID 113371994
[4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol (PubChem CID 113371994) has the molecular formula C14H12Cl2OS and a molecular weight of 299.22 g/mol. Its IUPAC name is [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol.
| Compound Name | [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol |
|---|---|
| PubChem CID | 113371994 |
| Molecular Formula | C14H12Cl2OS |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol |
| SMILES | OCc1ccc(SCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H12Cl2OS/c15-12-4-3-11(14(16)7-12)9-18-13-5-1-10(8-17)2-6-13/h1-7,17H,8-9H2 |
| InChIKey | JFQATZBWOQWNEP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |