About [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol
[4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol (PubChem CID 113371994) has the molecular formula C14H12Cl2OS
and a molecular weight of 299.22 g/mol. Its IUPAC name is [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol |
| PubChem CID | 113371994 |
| Molecular Formula | C14H12Cl2OS |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol |
| SMILES | OCc1ccc(SCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H12Cl2OS/c15-12-4-3-11(14(16)7-12)9-18-13-5-1-10(8-17)2-6-13/h1-7,17H,8-9H2 |
| InChIKey | JFQATZBWOQWNEP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol?
The IUPAC name of [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol (CID 113371994) is [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol.
What is the SMILES notation for [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol?
The canonical SMILES for [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol is OCc1ccc(SCc2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol?
The InChIKey is JFQATZBWOQWNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2OS/c15-12-4-3-11(14(16)7-12)9-18-13-5-1-10(8-17)2-6-13/h1-7,17H,8-9H2.
What are the key properties of [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol?
[4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol has a molecular weight of 299.22 g/mol, XLogP of 4.78, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]methanol is sourced from PubChem (CID 113371994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).