C17H18Cl2O — CID 142816012
[4-[3-(2,4-dichlorophenyl)-2-methylpropyl]phenyl]methanol (PubChem CID 142816012) has the molecular formula C17H18Cl2O and a molecular weight of 309.24 g/mol. Its IUPAC name is [4-[3-(2,4-dichlorophenyl)-2-methylpropyl]phenyl]methanol.
| Compound Name | [4-[3-(2,4-dichlorophenyl)-2-methylpropyl]phenyl]methanol |
|---|---|
| PubChem CID | 142816012 |
| Molecular Formula | C17H18Cl2O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | [4-[3-(2,4-dichlorophenyl)-2-methylpropyl]phenyl]methanol |
| SMILES | CC(Cc1ccc(CO)cc1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H18Cl2O/c1-12(8-13-2-4-14(11-20)5-3-13)9-15-6-7-16(18)10-17(15)19/h2-7,10,12,20H,8-9,11H2,1H3 |
| InChIKey | UOYPWNXGXYNBKT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |