C8H10Cl2N3+ — CID 6999882
diaminomethylidene-[(2,4-dichlorophenyl)methyl]azanium (PubChem CID 6999882) has the molecular formula C8H10Cl2N3+ and a molecular weight of 219.10 g/mol. Its IUPAC name is diaminomethylidene-[(2,4-dichlorophenyl)methyl]azanium.
| Compound Name | diaminomethylidene-[(2,4-dichlorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 6999882 |
| Molecular Formula | C8H10Cl2N3+ |
| Molecular Weight | 219.10 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | diaminomethylidene-[(2,4-dichlorophenyl)methyl]azanium |
| SMILES | NC(N)=[NH+]Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H9Cl2N3/c9-6-2-1-5(7(10)3-6)4-13-8(11)12/h1-3H,4H2,(H4,11,12,13)/p+1 |
| InChIKey | MIZQCZHCPNSFBI-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.10 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|