C8H10Cl2N2 — CID 82282939
1-[(2,4-dichlorophenyl)methyl]-1-methylhydrazine (PubChem CID 82282939) has the molecular formula C8H10Cl2N2 and a molecular weight of 205.09 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-1-methylhydrazine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 82282939 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-1-methylhydrazine |
| SMILES | CN(N)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H10Cl2N2/c1-12(11)5-6-2-3-7(9)4-8(6)10/h2-4H,5,11H2,1H3 |
| InChIKey | CMEXEWFRWZMJDJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|