C12H17Cl2N — CID 5150681
N-[(2,4-dichlorophenyl)methyl]-N-methylbutan-1-amine (PubChem CID 5150681) has the molecular formula C12H17Cl2N and a molecular weight of 246.18 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-methylbutan-1-amine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 5150681 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-methylbutan-1-amine |
| SMILES | CCCCN(C)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N/c1-3-4-7-15(2)9-10-5-6-11(13)8-12(10)14/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | FCWUYEKYAHIFTO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |