C18H14FNO4S — CID 25052474
[4-[(E)-2-cyano-2-[(4-fluorophenyl)methylsulfonyl]ethenyl]phenyl] acetate (PubChem CID 25052474) has the molecular formula C18H14FNO4S and a molecular weight of 359.38 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-[(4-fluorophenyl)methylsulfonyl]ethenyl]phenyl] acetate.
| Compound Name | [4-[(E)-2-cyano-2-[(4-fluorophenyl)methylsulfonyl]ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 25052474 |
| Molecular Formula | C18H14FNO4S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [4-[(E)-2-cyano-2-[(4-fluorophenyl)methylsulfonyl]ethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C(\C#N)S(=O)(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H14FNO4S/c1-13(21)24-17-8-4-14(5-9-17)10-18(11-20)25(22,23)12-15-2-6-16(19)7-3-15/h2-10H,12H2,1H3/b18-10+ |
| InChIKey | YQKZSABOMRTOPU-VCHYOVAHSA-N |
| XLogP | 3.23 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|