C15H13NO4S — CID 68943906
(E)-3-(furan-3-yl)-2-[(4-methoxyphenyl)methylsulfonyl]prop-2-enenitrile (PubChem CID 68943906) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is (E)-3-(furan-3-yl)-2-[(4-methoxyphenyl)methylsulfonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(furan-3-yl)-2-[(4-methoxyphenyl)methylsulfonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 68943906 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (E)-3-(furan-3-yl)-2-[(4-methoxyphenyl)methylsulfonyl]prop-2-enenitrile |
| SMILES | COc1ccc(CS(=O)(=O)/C(C#N)=C/c2ccoc2)cc1 |
| InChI | InChI=1S/C15H13NO4S/c1-19-14-4-2-12(3-5-14)11-21(17,18)15(9-16)8-13-6-7-20-10-13/h2-8,10H,11H2,1H3/b15-8+ |
| InChIKey | YBPGOBIYYHOWPN-OVCLIPMQSA-N |
| XLogP | 2.77 |
| TPSA | 80.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|