C18H14N2O5S — CID 68946998
(Z)-2-[(4-methoxyphenyl)methylsulfonyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enenitrile (PubChem CID 68946998) has the molecular formula C18H14N2O5S and a molecular weight of 370.39 g/mol. Its IUPAC name is (Z)-2-[(4-methoxyphenyl)methylsulfonyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-[(4-methoxyphenyl)methylsulfonyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68946998 |
| Molecular Formula | C18H14N2O5S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | (Z)-2-[(4-methoxyphenyl)methylsulfonyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enenitrile |
| SMILES | COc1ccc(CS(=O)(=O)/C(C#N)=C\c2ccc3oc(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C18H14N2O5S/c1-24-14-5-2-12(3-6-14)11-26(22,23)15(10-19)8-13-4-7-17-16(9-13)20-18(21)25-17/h2-9H,11H2,1H3,(H,20,21)/b15-8- |
| InChIKey | VEEPULONSDRTRG-NVNXTCNLSA-N |
| XLogP | 2.61 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|