C19H16N2O6S — CID 68946140
(E)-2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enenitrile (PubChem CID 68946140) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is (E)-2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68946140 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (E)-2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enenitrile |
| SMILES | COc1ccc(CS(=O)(=O)/C(C#N)=C/c2ccc3oc(=O)[nH]c3c2)cc1OC |
| InChI | InChI=1S/C19H16N2O6S/c1-25-17-6-4-13(9-18(17)26-2)11-28(23,24)14(10-20)7-12-3-5-16-15(8-12)21-19(22)27-16/h3-9H,11H2,1-2H3,(H,21,22)/b14-7+ |
| InChIKey | TZODFXADLXTJRN-VGOFMYFVSA-N |
| XLogP | 2.62 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|