C18H16N2O4S — CID 68946902
(E)-2-[(4-methoxyphenyl)methylsulfanyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enamide (PubChem CID 68946902) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is (E)-2-[(4-methoxyphenyl)methylsulfanyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enamide.
| Compound Name | (E)-2-[(4-methoxyphenyl)methylsulfanyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 68946902 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (E)-2-[(4-methoxyphenyl)methylsulfanyl]-3-(2-oxo-3H-1,3-benzoxazol-5-yl)prop-2-enamide |
| SMILES | COc1ccc(CS/C(=C/c2ccc3oc(=O)[nH]c3c2)C(N)=O)cc1 |
| InChI | InChI=1S/C18H16N2O4S/c1-23-13-5-2-11(3-6-13)10-25-16(17(19)21)9-12-4-7-15-14(8-12)20-18(22)24-15/h2-9H,10H2,1H3,(H2,19,21)(H,20,22)/b16-9+ |
| InChIKey | NDKKNOFLAMVTPX-CXUHLZMHSA-N |
| XLogP | 2.89 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|