C9H7NO4 — CID 175493063
(2-oxo-3H-1,3-benzoxazol-5-yl) acetate (PubChem CID 175493063) has the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. Its IUPAC name is (2-oxo-3H-1,3-benzoxazol-5-yl) acetate.
| Compound Name | (2-oxo-3H-1,3-benzoxazol-5-yl) acetate |
|---|---|
| PubChem CID | 175493063 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | (2-oxo-3H-1,3-benzoxazol-5-yl) acetate |
| SMILES | CC(=O)Oc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H7NO4/c1-5(11)13-6-2-3-8-7(4-6)10-9(12)14-8/h2-4H,1H3,(H,10,12) |
| InChIKey | BUTNUKHWDOXNID-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|