C7H6N2O2 — CID 26856
5-amino-3H-1,3-benzoxazol-2-one (PubChem CID 26856) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is 5-amino-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-amino-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 26856 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 5-amino-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C7H6N2O2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,8H2,(H,9,10) |
| InChIKey | GJXXUHGUCBUXSL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|