C8H7Cl3N2O2 — CID 161389670
6-amino-3H-1,3-benzoxazol-2-one;chloroform (PubChem CID 161389670) has the molecular formula C8H7Cl3N2O2 and a molecular weight of 269.52 g/mol. Its IUPAC name is 6-amino-3H-1,3-benzoxazol-2-one;chloroform.
| Compound Name | 6-amino-3H-1,3-benzoxazol-2-one;chloroform |
|---|---|
| PubChem CID | 161389670 |
| Molecular Formula | C8H7Cl3N2O2 |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 6-amino-3H-1,3-benzoxazol-2-one;chloroform |
| SMILES | ClC(Cl)Cl.Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C7H6N2O2.CHCl3/c8-4-1-2-5-6(3-4)11-7(10)9-5;2-1(3)4/h1-3H,8H2,(H,9,10);1H |
| InChIKey | VSUXXXBYYJIPHJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|