C14H8Cl3NO2 — CID 61086643
6-[chloro-(3,5-dichlorophenyl)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 61086643) has the molecular formula C14H8Cl3NO2 and a molecular weight of 328.58 g/mol. Its IUPAC name is 6-[chloro-(3,5-dichlorophenyl)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[chloro-(3,5-dichlorophenyl)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61086643 |
| Molecular Formula | C14H8Cl3NO2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 6-[chloro-(3,5-dichlorophenyl)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Cl)c3cc(Cl)cc(Cl)c3)cc2o1 |
| InChI | InChI=1S/C14H8Cl3NO2/c15-9-3-8(4-10(16)6-9)13(17)7-1-2-11-12(5-7)20-14(19)18-11/h1-6,13H,(H,18,19) |
| InChIKey | QHCPQZCZTHQUMI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|