C14H9ClINO2 — CID 61084010
6-[chloro-(3-iodophenyl)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 61084010) has the molecular formula C14H9ClINO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is 6-[chloro-(3-iodophenyl)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[chloro-(3-iodophenyl)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61084010 |
| Molecular Formula | C14H9ClINO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | 6-[chloro-(3-iodophenyl)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Cl)c3cccc(I)c3)cc2o1 |
| InChI | InChI=1S/C14H9ClINO2/c15-13(8-2-1-3-10(16)6-8)9-4-5-11-12(7-9)19-14(18)17-11/h1-7,13H,(H,17,18) |
| InChIKey | FZJXPTZHDMZGCG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|