C10H5ClF5NO2 — CID 61084407
6-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3H-1,3-benzoxazol-2-one (PubChem CID 61084407) has the molecular formula C10H5ClF5NO2 and a molecular weight of 301.60 g/mol. Its IUPAC name is 6-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61084407 |
| Molecular Formula | C10H5ClF5NO2 |
| Molecular Weight | 301.60 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 6-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Cl)C(F)(F)C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C10H5ClF5NO2/c11-7(9(12,13)10(14,15)16)4-1-2-5-6(3-4)19-8(18)17-5/h1-3,7H,(H,17,18) |
| InChIKey | GIRGJJLBWBRYOW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|