C9H11N3O2 — CID 116855514
6-(1,2-diaminoethyl)-3H-1,3-benzoxazol-2-one (PubChem CID 116855514) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 6-(1,2-diaminoethyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(1,2-diaminoethyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116855514 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-(1,2-diaminoethyl)-3H-1,3-benzoxazol-2-one |
| SMILES | NCC(N)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C9H11N3O2/c10-4-6(11)5-1-2-7-8(3-5)14-9(13)12-7/h1-3,6H,4,10-11H2,(H,12,13) |
| InChIKey | HEWKQQJWSBKNRO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |