C13H19N3O2 — CID 116934795
6-(1,4-diamino-4-methylpentyl)-3H-1,3-benzoxazol-2-one (PubChem CID 116934795) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 6-(1,4-diamino-4-methylpentyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(1,4-diamino-4-methylpentyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116934795 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 6-(1,4-diamino-4-methylpentyl)-3H-1,3-benzoxazol-2-one |
| SMILES | CC(C)(N)CCC(N)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C13H19N3O2/c1-13(2,15)6-5-9(14)8-3-4-10-11(7-8)18-12(17)16-10/h3-4,7,9H,5-6,14-15H2,1-2H3,(H,16,17) |
| InChIKey | MXKPOQVCTMWMNO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |