C10H13N3O2 — CID 116855628
6-(1,2-diaminopropan-2-yl)-3H-1,3-benzoxazol-2-one (PubChem CID 116855628) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 6-(1,2-diaminopropan-2-yl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(1,2-diaminopropan-2-yl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116855628 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 6-(1,2-diaminopropan-2-yl)-3H-1,3-benzoxazol-2-one |
| SMILES | CC(N)(CN)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H13N3O2/c1-10(12,5-11)6-2-3-7-8(4-6)15-9(14)13-7/h2-4H,5,11-12H2,1H3,(H,13,14) |
| InChIKey | VABFXNDZFIGTRA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |