C10H10N2O2 — CID 169463735
6-(3-aminoprop-1-enyl)-3H-1,3-benzoxazol-2-one (PubChem CID 169463735) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 6-(3-aminoprop-1-enyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(3-aminoprop-1-enyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 169463735 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 6-(3-aminoprop-1-enyl)-3H-1,3-benzoxazol-2-one |
| SMILES | NCC=Cc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H10N2O2/c11-5-1-2-7-3-4-8-9(6-7)14-10(13)12-8/h1-4,6H,5,11H2,(H,12,13) |
| InChIKey | DJLCHMFNTXHIJG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |