C10H6N2O2 — CID 142272083
(Z)-3-(2-oxo-3H-1,3-benzoxazol-6-yl)prop-2-enenitrile (PubChem CID 142272083) has the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. Its IUPAC name is (Z)-3-(2-oxo-3H-1,3-benzoxazol-6-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(2-oxo-3H-1,3-benzoxazol-6-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 142272083 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (Z)-3-(2-oxo-3H-1,3-benzoxazol-6-yl)prop-2-enenitrile |
| SMILES | N#C/C=C\c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H6N2O2/c11-5-1-2-7-3-4-8-9(6-7)14-10(13)12-8/h1-4,6H,(H,12,13)/b2-1- |
| InChIKey | WBGSFIBVXINVQG-UPHRSURJSA-N |
| XLogP | 1.66 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|