C9H6N2O2S — CID 116853847
2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfanyl]acetonitrile (PubChem CID 116853847) has the molecular formula C9H6N2O2S and a molecular weight of 206.23 g/mol. Its IUPAC name is 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfanyl]acetonitrile.
| Compound Name | 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfanyl]acetonitrile |
|---|---|
| PubChem CID | 116853847 |
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfanyl]acetonitrile |
| SMILES | N#CCSc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C9H6N2O2S/c10-3-4-14-6-1-2-7-8(5-6)13-9(12)11-7/h1-2,5H,4H2,(H,11,12) |
| InChIKey | QVMLKGQZLUDLGV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |