C10H11NO3 — CID 117283453
5-(2-hydroxypropan-2-yl)-3H-1,3-benzoxazol-2-one (PubChem CID 117283453) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 5-(2-hydroxypropan-2-yl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(2-hydroxypropan-2-yl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 117283453 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-(2-hydroxypropan-2-yl)-3H-1,3-benzoxazol-2-one |
| SMILES | CC(C)(O)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H11NO3/c1-10(2,13)6-3-4-8-7(5-6)11-9(12)14-8/h3-5,13H,1-2H3,(H,11,12) |
| InChIKey | UYZJJRUREDTICE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |