C14H21N3O2 — CID 115196207
5-[2-methyl-1-[2-(methylamino)ethylamino]propan-2-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 115196207) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-[2-methyl-1-[2-(methylamino)ethylamino]propan-2-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[2-methyl-1-[2-(methylamino)ethylamino]propan-2-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115196207 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 5-[2-methyl-1-[2-(methylamino)ethylamino]propan-2-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | CNCCNCC(C)(C)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H21N3O2/c1-14(2,9-16-7-6-15-3)10-4-5-12-11(8-10)17-13(18)19-12/h4-5,8,15-16H,6-7,9H2,1-3H3,(H,17,18) |
| InChIKey | DODZIYHHMYMHTC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|