C9H9ClN2O2 — CID 115214645
5-(2-chloroethylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 115214645) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is 5-(2-chloroethylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(2-chloroethylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115214645 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 5-(2-chloroethylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(NCCCl)ccc2o1 |
| InChI | InChI=1S/C9H9ClN2O2/c10-3-4-11-6-1-2-8-7(5-6)12-9(13)14-8/h1-2,5,11H,3-4H2,(H,12,13) |
| InChIKey | ZNHYLEIWMPTVGZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|