C12H9IN2O3 — CID 43790112
5-[(5-iodofuran-2-yl)methylamino]-3H-1,3-benzoxazol-2-one (PubChem CID 43790112) has the molecular formula C12H9IN2O3 and a molecular weight of 356.12 g/mol. Its IUPAC name is 5-[(5-iodofuran-2-yl)methylamino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[(5-iodofuran-2-yl)methylamino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43790112 |
| Molecular Formula | C12H9IN2O3 |
| Molecular Weight | 356.12 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 5-[(5-iodofuran-2-yl)methylamino]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(NCc3ccc(I)o3)ccc2o1 |
| InChI | InChI=1S/C12H9IN2O3/c13-11-4-2-8(17-11)6-14-7-1-3-10-9(5-7)15-12(16)18-10/h1-5,14H,6H2,(H,15,16) |
| InChIKey | OSWFDEPBPVMQAA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.12 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|