About 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one
5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one (PubChem CID 99793336) has the molecular formula C14H14N2O3
and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one |
| PubChem CID | 99793336 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1cc(CNc2ccc3oc(=O)[nH]c3c2)c(C)o1 |
| InChI | InChI=1S/C14H14N2O3/c1-8-5-10(9(2)18-8)7-15-11-3-4-13-12(6-11)16-14(17)19-13/h3-6,15H,7H2,1-2H3,(H,16,17) |
| InChIKey | OBXIYBLXPQHCLX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one?
The IUPAC name of 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one (CID 99793336) is 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one is Cc1cc(CNc2ccc3oc(=O)[nH]c3c2)c(C)o1.
What is the InChIKey of 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one?
The InChIKey is OBXIYBLXPQHCLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3/c1-8-5-10(9(2)18-8)7-15-11-3-4-13-12(6-11)16-14(17)19-13/h3-6,15H,7H2,1-2H3,(H,16,17).
What are the key properties of 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one?
5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one has a molecular weight of 258.28 g/mol, XLogP of 2.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 99793336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).