C14H14N2O3 — CID 99793336
5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one (PubChem CID 99793336) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 99793336 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-[(2,5-dimethylfuran-3-yl)methylamino]-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1cc(CNc2ccc3oc(=O)[nH]c3c2)c(C)o1 |
| InChI | InChI=1S/C14H14N2O3/c1-8-5-10(9(2)18-8)7-15-11-3-4-13-12(6-11)16-14(17)19-13/h3-6,15H,7H2,1-2H3,(H,16,17) |
| InChIKey | OBXIYBLXPQHCLX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |