C14H10F2N2O2 — CID 99793337
5-[(3,5-difluorophenyl)methylamino]-3H-1,3-benzoxazol-2-one (PubChem CID 99793337) has the molecular formula C14H10F2N2O2 and a molecular weight of 276.24 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)methylamino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[(3,5-difluorophenyl)methylamino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 99793337 |
| Molecular Formula | C14H10F2N2O2 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-[(3,5-difluorophenyl)methylamino]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(NCc3cc(F)cc(F)c3)ccc2o1 |
| InChI | InChI=1S/C14H10F2N2O2/c15-9-3-8(4-10(16)5-9)7-17-11-1-2-13-12(6-11)18-14(19)20-13/h1-6,17H,7H2,(H,18,19) |
| InChIKey | MLYISCZAYTXROD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |