C16H15FN2O2 — CID 114829036
5-[1-(4-fluorophenyl)propan-2-ylamino]-3H-1,3-benzoxazol-2-one (PubChem CID 114829036) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 5-[1-(4-fluorophenyl)propan-2-ylamino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[1-(4-fluorophenyl)propan-2-ylamino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 114829036 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-[1-(4-fluorophenyl)propan-2-ylamino]-3H-1,3-benzoxazol-2-one |
| SMILES | CC(Cc1ccc(F)cc1)Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H15FN2O2/c1-10(8-11-2-4-12(17)5-3-11)18-13-6-7-15-14(9-13)19-16(20)21-15/h2-7,9-10,18H,8H2,1H3,(H,19,20) |
| InChIKey | DZQMKZHDCUMYFH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |