C12H10N2O3 — CID 63204507
5-(furan-3-ylmethylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 63204507) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 5-(furan-3-ylmethylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(furan-3-ylmethylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 63204507 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5-(furan-3-ylmethylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(NCc3ccoc3)ccc2o1 |
| InChI | InChI=1S/C12H10N2O3/c15-12-14-10-5-9(1-2-11(10)17-12)13-6-8-3-4-16-7-8/h1-5,7,13H,6H2,(H,14,15) |
| InChIKey | IDYHASNAENTPLL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |