About methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate
methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate (PubChem CID 43790129) has the molecular formula C14H12N2O5
and a molecular weight of 288.26 g/mol. Its IUPAC name is methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate |
| PubChem CID | 43790129 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H12N2O5/c1-19-13(17)12-8(4-5-20-12)7-15-9-2-3-11-10(6-9)16-14(18)21-11/h2-6,15H,7H2,1H3,(H,16,18) |
| InChIKey | RZXBWGVFSSRLOT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate?
The IUPAC name of methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate (CID 43790129) is methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate.
What is the SMILES notation for methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate?
The canonical SMILES for methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate is COC(=O)c1occc1CNc1ccc2oc(=O)[nH]c2c1.
What is the InChIKey of methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate?
The InChIKey is RZXBWGVFSSRLOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O5/c1-19-13(17)12-8(4-5-20-12)7-15-9-2-3-11-10(6-9)16-14(18)21-11/h2-6,15H,7H2,1H3,(H,16,18).
What are the key properties of methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate?
methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate has a molecular weight of 288.26 g/mol, XLogP of 2.11, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]methyl]furan-2-carboxylate is sourced from PubChem (CID 43790129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).