C13H17N3O2 — CID 79707132
5-(piperidin-4-ylmethylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 79707132) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-(piperidin-4-ylmethylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(piperidin-4-ylmethylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79707132 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 5-(piperidin-4-ylmethylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(NCC3CCNCC3)ccc2o1 |
| InChI | InChI=1S/C13H17N3O2/c17-13-16-11-7-10(1-2-12(11)18-13)15-8-9-3-5-14-6-4-9/h1-2,7,9,14-15H,3-6,8H2,(H,16,17) |
| InChIKey | OSLIYFMCUQWSNQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |