C13H10N2O3 — CID 114996939
6-[hydroxy(pyridin-4-yl)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 114996939) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 6-[hydroxy(pyridin-4-yl)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[hydroxy(pyridin-4-yl)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 114996939 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 6-[hydroxy(pyridin-4-yl)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(O)c3ccncc3)cc2o1 |
| InChI | InChI=1S/C13H10N2O3/c16-12(8-3-5-14-6-4-8)9-1-2-10-11(7-9)18-13(17)15-10/h1-7,12,16H,(H,15,17) |
| InChIKey | MJBIWEVVGOVHIT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |