C14H10N4O6 — CID 157138792
6-amino-3H-1,3-benzoxazol-2-one;6-nitro-3H-1,3-benzoxazol-2-one (PubChem CID 157138792) has the molecular formula C14H10N4O6 and a molecular weight of 330.26 g/mol. Its IUPAC name is 6-amino-3H-1,3-benzoxazol-2-one;6-nitro-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-3H-1,3-benzoxazol-2-one;6-nitro-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 157138792 |
| Molecular Formula | C14H10N4O6 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 6-amino-3H-1,3-benzoxazol-2-one;6-nitro-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1ccc2[nH]c(=O)oc2c1.O=c1[nH]c2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C7H4N2O4.C7H6N2O2/c10-7-8-5-2-1-4(9(11)12)3-6(5)13-7;8-4-1-2-5-6(3-4)11-7(10)9-5/h1-3H,(H,8,10);1-3H,8H2,(H,9,10) |
| InChIKey | AJYFCNTVISTEPQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|