C12H8N4O5 — CID 158966231
6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine (PubChem CID 158966231) has the molecular formula C12H8N4O5 and a molecular weight of 288.22 g/mol. Its IUPAC name is 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine.
| Compound Name | 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine |
|---|---|
| PubChem CID | 158966231 |
| Molecular Formula | C12H8N4O5 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine |
| SMILES | O=c1[nH]c(=O)c2cc([N+](=O)[O-])ccc2o1.c1cncnc1 |
| InChI | InChI=1S/C8H4N2O5.C4H4N2/c11-7-5-3-4(10(13)14)1-2-6(5)15-8(12)9-7;1-2-5-4-6-3-1/h1-3H,(H,9,11,12);1-4H |
| InChIKey | JNFVGSMYLGPPAM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|