About 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine
6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine (PubChem CID 158966231) has the molecular formula C12H8N4O5
and a molecular weight of 288.22 g/mol. Its IUPAC name is 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine.
Molecular Properties
| Compound Name | 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine |
| PubChem CID | 158966231 |
| Molecular Formula | C12H8N4O5 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine |
| SMILES | O=c1[nH]c(=O)c2cc([N+](=O)[O-])ccc2o1.c1cncnc1 |
| InChI | InChI=1S/C8H4N2O5.C4H4N2/c11-7-5-3-4(10(13)14)1-2-6(5)15-8(12)9-7;1-2-5-4-6-3-1/h1-3H,(H,9,11,12);1-4H |
| InChIKey | JNFVGSMYLGPPAM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine?
The IUPAC name of 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine (CID 158966231) is 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine.
What is the SMILES notation for 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine?
The canonical SMILES for 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine is O=c1[nH]c(=O)c2cc([N+](=O)[O-])ccc2o1.c1cncnc1.
What is the InChIKey of 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine?
The InChIKey is JNFVGSMYLGPPAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O5.C4H4N2/c11-7-5-3-4(10(13)14)1-2-6(5)15-8(12)9-7;1-2-5-4-6-3-1/h1-3H,(H,9,11,12);1-4H.
What are the key properties of 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine?
6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine has a molecular weight of 288.22 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-1,3-benzoxazine-2,4-dione;pyrimidine is sourced from PubChem (CID 158966231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).