About 2-bromo-3,8-dinitrodibenzofuran
2-bromo-3,8-dinitrodibenzofuran (PubChem CID 121008106) has the molecular formula C12H5BrN2O5
and a molecular weight of 337.09 g/mol. Its IUPAC name is 2-bromo-3,8-dinitrodibenzofuran.
Molecular Properties
| Compound Name | 2-bromo-3,8-dinitrodibenzofuran |
| PubChem CID | 121008106 |
| Molecular Formula | C12H5BrN2O5 |
| Molecular Weight | 337.09 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 2-bromo-3,8-dinitrodibenzofuran |
| SMILES | O=[N+]([O-])c1ccc2oc3cc([N+](=O)[O-])c(Br)cc3c2c1 |
| InChI | InChI=1S/C12H5BrN2O5/c13-9-4-8-7-3-6(14(16)17)1-2-11(7)20-12(8)5-10(9)15(18)19/h1-5H |
| InChIKey | OXWLUNAVLXQNGH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 99.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.09 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3,8-dinitrodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,8-dinitrodibenzofuran?
The IUPAC name of 2-bromo-3,8-dinitrodibenzofuran (CID 121008106) is 2-bromo-3,8-dinitrodibenzofuran.
What is the SMILES notation for 2-bromo-3,8-dinitrodibenzofuran?
The canonical SMILES for 2-bromo-3,8-dinitrodibenzofuran is O=[N+]([O-])c1ccc2oc3cc([N+](=O)[O-])c(Br)cc3c2c1.
What is the InChIKey of 2-bromo-3,8-dinitrodibenzofuran?
The InChIKey is OXWLUNAVLXQNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5BrN2O5/c13-9-4-8-7-3-6(14(16)17)1-2-11(7)20-12(8)5-10(9)15(18)19/h1-5H.
What are the key properties of 2-bromo-3,8-dinitrodibenzofuran?
2-bromo-3,8-dinitrodibenzofuran has a molecular weight of 337.09 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,8-dinitrodibenzofuran is sourced from PubChem (CID 121008106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).