C18H17BrN2O7S — CID 68507426
methyl 2-[(8-bromo-7-nitrodibenzofuran-3-yl)sulfonylamino]-3-methylbutanoate (PubChem CID 68507426) has the molecular formula C18H17BrN2O7S and a molecular weight of 485.31 g/mol. Its IUPAC name is methyl 2-[(8-bromo-7-nitrodibenzofuran-3-yl)sulfonylamino]-3-methylbutanoate.
| Compound Name | methyl 2-[(8-bromo-7-nitrodibenzofuran-3-yl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 68507426 |
| Molecular Formula | C18H17BrN2O7S |
| Molecular Weight | 485.31 g/mol |
| Exact Mass | 483.99 |
| IUPAC Name | methyl 2-[(8-bromo-7-nitrodibenzofuran-3-yl)sulfonylamino]-3-methylbutanoate |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccc2c(c1)oc1cc([N+](=O)[O-])c(Br)cc12)C(C)C |
| InChI | InChI=1S/C18H17BrN2O7S/c1-9(2)17(18(22)27-3)20-29(25,26)10-4-5-11-12-7-13(19)14(21(23)24)8-16(12)28-15(11)6-10/h4-9,17,20H,1-3H3 |
| InChIKey | JFBHBCDTXBPTAH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|