C18H18N2O6S2 — CID 59477411
methyl (2R)-3-methyl-2-[(7-nitrodibenzothiophen-2-yl)sulfonylamino]butanoate (PubChem CID 59477411) has the molecular formula C18H18N2O6S2 and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl (2R)-3-methyl-2-[(7-nitrodibenzothiophen-2-yl)sulfonylamino]butanoate.
| Compound Name | methyl (2R)-3-methyl-2-[(7-nitrodibenzothiophen-2-yl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 59477411 |
| Molecular Formula | C18H18N2O6S2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | methyl (2R)-3-methyl-2-[(7-nitrodibenzothiophen-2-yl)sulfonylamino]butanoate |
| SMILES | COC(=O)[C@H](NS(=O)(=O)c1ccc2sc3cc([N+](=O)[O-])ccc3c2c1)C(C)C |
| InChI | InChI=1S/C18H18N2O6S2/c1-10(2)17(18(21)26-3)19-28(24,25)12-5-7-15-14(9-12)13-6-4-11(20(22)23)8-16(13)27-15/h4-10,17,19H,1-3H3/t17-/m1/s1 |
| InChIKey | PWZJILMROPRBMI-QGZVFWFLSA-N |
| XLogP | 3.44 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|