C22H28N2O4S2 — CID 68877307
tert-butyl (2S)-3-methyl-2-[[7-(methylamino)dibenzothiophen-3-yl]sulfonylamino]butanoate (PubChem CID 68877307) has the molecular formula C22H28N2O4S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[7-(methylamino)dibenzothiophen-3-yl]sulfonylamino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[7-(methylamino)dibenzothiophen-3-yl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 68877307 |
| Molecular Formula | C22H28N2O4S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[7-(methylamino)dibenzothiophen-3-yl]sulfonylamino]butanoate |
| SMILES | CNc1ccc2c(c1)sc1cc(S(=O)(=O)N[C@H](C(=O)OC(C)(C)C)C(C)C)ccc12 |
| InChI | InChI=1S/C22H28N2O4S2/c1-13(2)20(21(25)28-22(3,4)5)24-30(26,27)15-8-10-17-16-9-7-14(23-6)11-18(16)29-19(17)12-15/h7-13,20,23-24H,1-6H3/t20-/m0/s1 |
| InChIKey | WKCLLNZRIGQWPK-FQEVSTJZSA-N |
| XLogP | 4.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |