C19H21N3O6S — CID 59477255
methyl (2S)-2-[[8-[(Z)-N'-hydroxycarbamimidoyl]dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoate (PubChem CID 59477255) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is methyl (2S)-2-[[8-[(Z)-N'-hydroxycarbamimidoyl]dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[8-[(Z)-N'-hydroxycarbamimidoyl]dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 59477255 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | methyl (2S)-2-[[8-[(Z)-N'-hydroxycarbamimidoyl]dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NS(=O)(=O)c1ccc2c(c1)oc1ccc(/C(N)=N/O)cc12)C(C)C |
| InChI | InChI=1S/C19H21N3O6S/c1-10(2)17(19(23)27-3)22-29(25,26)12-5-6-13-14-8-11(18(20)21-24)4-7-15(14)28-16(13)9-12/h4-10,17,22,24H,1-3H3,(H2,20,21)/t17-/m0/s1 |
| InChIKey | FXTOSAAZKKOJSG-KRWDZBQOSA-N |
| XLogP | 2.16 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|