C12H4Br2N2O5 — CID 121009366
2,7-dibromo-3,8-dinitrodibenzofuran (PubChem CID 121009366) has the molecular formula C12H4Br2N2O5 and a molecular weight of 415.98 g/mol. Its IUPAC name is 2,7-dibromo-3,8-dinitrodibenzofuran.
| Compound Name | 2,7-dibromo-3,8-dinitrodibenzofuran |
|---|---|
| PubChem CID | 121009366 |
| Molecular Formula | C12H4Br2N2O5 |
| Molecular Weight | 415.98 g/mol |
| Exact Mass | 413.85 |
| IUPAC Name | 2,7-dibromo-3,8-dinitrodibenzofuran |
| SMILES | O=[N+]([O-])c1cc2oc3cc(Br)c([N+](=O)[O-])cc3c2cc1Br |
| InChI | InChI=1S/C12H4Br2N2O5/c13-7-1-5-6-2-9(15(17)18)8(14)3-11(6)21-12(5)4-10(7)16(19)20/h1-4H |
| InChIKey | NOWSGPXLIHCWEX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 99.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.98 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|