C14H9BrN2O5 — CID 135005070
2-(5-bromo-2,4-dinitrophenyl)-1-phenylethanone (PubChem CID 135005070) has the molecular formula C14H9BrN2O5 and a molecular weight of 365.14 g/mol. Its IUPAC name is 2-(5-bromo-2,4-dinitrophenyl)-1-phenylethanone.
| Compound Name | 2-(5-bromo-2,4-dinitrophenyl)-1-phenylethanone |
|---|---|
| PubChem CID | 135005070 |
| Molecular Formula | C14H9BrN2O5 |
| Molecular Weight | 365.14 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 2-(5-bromo-2,4-dinitrophenyl)-1-phenylethanone |
| SMILES | O=C(Cc1cc(Br)c([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C14H9BrN2O5/c15-11-6-10(7-14(18)9-4-2-1-3-5-9)12(16(19)20)8-13(11)17(21)22/h1-6,8H,7H2 |
| InChIKey | ICFHYOBGUSLUEH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.14 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|