C22H16N2O6 — CID 2748910
2-(2,4-dinitro-5-phenacylphenyl)-1-phenylethanone (PubChem CID 2748910) has the molecular formula C22H16N2O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is 2-(2,4-dinitro-5-phenacylphenyl)-1-phenylethanone.
| Compound Name | 2-(2,4-dinitro-5-phenacylphenyl)-1-phenylethanone |
|---|---|
| PubChem CID | 2748910 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-(2,4-dinitro-5-phenacylphenyl)-1-phenylethanone |
| SMILES | O=C(Cc1cc(CC(=O)c2ccccc2)c([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C22H16N2O6/c25-21(15-7-3-1-4-8-15)12-17-11-18(13-22(26)16-9-5-2-6-10-16)20(24(29)30)14-19(17)23(27)28/h1-11,14H,12-13H2 |
| InChIKey | RAWVDBOQZCINPP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|